About 3-ethoxy-2-propoxyphenol
3-ethoxy-2-propoxyphenol (PubChem CID 174814735) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-ethoxy-2-propoxyphenol.
Molecular Properties
| Compound Name | 3-ethoxy-2-propoxyphenol |
| PubChem CID | 174814735 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-ethoxy-2-propoxyphenol |
| SMILES | CCCOc1c(O)cccc1OCC |
| InChI | InChI=1S/C11H16O3/c1-3-8-14-11-9(12)6-5-7-10(11)13-4-2/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | MOAXKGMQZYKLTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-2-propoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-propoxyphenol?
The IUPAC name of 3-ethoxy-2-propoxyphenol (CID 174814735) is 3-ethoxy-2-propoxyphenol.
What is the SMILES notation for 3-ethoxy-2-propoxyphenol?
The canonical SMILES for 3-ethoxy-2-propoxyphenol is CCCOc1c(O)cccc1OCC.
What is the InChIKey of 3-ethoxy-2-propoxyphenol?
The InChIKey is MOAXKGMQZYKLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-3-8-14-11-9(12)6-5-7-10(11)13-4-2/h5-7,12H,3-4,8H2,1-2H3.
What are the key properties of 3-ethoxy-2-propoxyphenol?
3-ethoxy-2-propoxyphenol has a molecular weight of 196.25 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-propoxyphenol is sourced from PubChem (CID 174814735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).