About 2,3-dipentoxyphenol
2,3-dipentoxyphenol (PubChem CID 57426098) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 2,3-dipentoxyphenol.
Molecular Properties
| Compound Name | 2,3-dipentoxyphenol |
| PubChem CID | 57426098 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2,3-dipentoxyphenol |
| SMILES | CCCCCOc1cccc(O)c1OCCCCC |
| InChI | InChI=1S/C16H26O3/c1-3-5-7-12-18-15-11-9-10-14(17)16(15)19-13-8-6-4-2/h9-11,17H,3-8,12-13H2,1-2H3 |
| InChIKey | ROTUVERPCCBAFF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dipentoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipentoxyphenol?
The IUPAC name of 2,3-dipentoxyphenol (CID 57426098) is 2,3-dipentoxyphenol.
What is the SMILES notation for 2,3-dipentoxyphenol?
The canonical SMILES for 2,3-dipentoxyphenol is CCCCCOc1cccc(O)c1OCCCCC.
What is the InChIKey of 2,3-dipentoxyphenol?
The InChIKey is ROTUVERPCCBAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3/c1-3-5-7-12-18-15-11-9-10-14(17)16(15)19-13-8-6-4-2/h9-11,17H,3-8,12-13H2,1-2H3.
What are the key properties of 2,3-dipentoxyphenol?
2,3-dipentoxyphenol has a molecular weight of 266.38 g/mol, XLogP of 4.53, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipentoxyphenol is sourced from PubChem (CID 57426098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).