C18H24O4 — CID 70150520
benzene-1,2-diol;2-hexoxyphenol (PubChem CID 70150520) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzene-1,2-diol;2-hexoxyphenol.
| Compound Name | benzene-1,2-diol;2-hexoxyphenol |
|---|---|
| PubChem CID | 70150520 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | benzene-1,2-diol;2-hexoxyphenol |
| SMILES | CCCCCCOc1ccccc1O.Oc1ccccc1O |
| InChI | InChI=1S/C12H18O2.C6H6O2/c1-2-3-4-7-10-14-12-9-6-5-8-11(12)13;7-5-3-1-2-4-6(5)8/h5-6,8-9,13H,2-4,7,10H2,1H3;1-4,7-8H |
| InChIKey | QSVDRBVCYOSDAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|