About 2-octoxyaniline
2-octoxyaniline (PubChem CID 14747235) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-octoxyaniline.
Molecular Properties
| Compound Name | 2-octoxyaniline |
| PubChem CID | 14747235 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-octoxyaniline |
| SMILES | CCCCCCCCOc1ccccc1N |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-5-6-9-12-16-14-11-8-7-10-13(14)15/h7-8,10-11H,2-6,9,12,15H2,1H3 |
| InChIKey | OGEFQWOGBSQSDP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxyaniline?
The IUPAC name of 2-octoxyaniline (CID 14747235) is 2-octoxyaniline.
What is the SMILES notation for 2-octoxyaniline?
The canonical SMILES for 2-octoxyaniline is CCCCCCCCOc1ccccc1N.
What is the InChIKey of 2-octoxyaniline?
The InChIKey is OGEFQWOGBSQSDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-2-3-4-5-6-9-12-16-14-11-8-7-10-13(14)15/h7-8,10-11H,2-6,9,12,15H2,1H3.
What are the key properties of 2-octoxyaniline?
2-octoxyaniline has a molecular weight of 221.34 g/mol, XLogP of 4.01, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxyaniline is sourced from PubChem (CID 14747235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).