About 4-fluoro-2-octoxyaniline
4-fluoro-2-octoxyaniline (PubChem CID 43128998) has the molecular formula C14H22FNO
and a molecular weight of 239.33 g/mol. Its IUPAC name is 4-fluoro-2-octoxyaniline.
Molecular Properties
| Compound Name | 4-fluoro-2-octoxyaniline |
| PubChem CID | 43128998 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 4-fluoro-2-octoxyaniline |
| SMILES | CCCCCCCCOc1cc(F)ccc1N |
| InChI | InChI=1S/C14H22FNO/c1-2-3-4-5-6-7-10-17-14-11-12(15)8-9-13(14)16/h8-9,11H,2-7,10,16H2,1H3 |
| InChIKey | CJTPDGHLBZONDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-octoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-octoxyaniline?
The IUPAC name of 4-fluoro-2-octoxyaniline (CID 43128998) is 4-fluoro-2-octoxyaniline.
What is the SMILES notation for 4-fluoro-2-octoxyaniline?
The canonical SMILES for 4-fluoro-2-octoxyaniline is CCCCCCCCOc1cc(F)ccc1N.
What is the InChIKey of 4-fluoro-2-octoxyaniline?
The InChIKey is CJTPDGHLBZONDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FNO/c1-2-3-4-5-6-7-10-17-14-11-12(15)8-9-13(14)16/h8-9,11H,2-7,10,16H2,1H3.
What are the key properties of 4-fluoro-2-octoxyaniline?
4-fluoro-2-octoxyaniline has a molecular weight of 239.33 g/mol, XLogP of 4.15, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-octoxyaniline is sourced from PubChem (CID 43128998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).