About 4-methylaniline;2-tetradecoxyaniline
4-methylaniline;2-tetradecoxyaniline (PubChem CID 158200068) has the molecular formula C27H44N2O
and a molecular weight of 412.66 g/mol. Its IUPAC name is 4-methylaniline;2-tetradecoxyaniline.
Molecular Properties
| Compound Name | 4-methylaniline;2-tetradecoxyaniline |
| PubChem CID | 158200068 |
| Molecular Formula | C27H44N2O |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.35 |
| IUPAC Name | 4-methylaniline;2-tetradecoxyaniline |
| SMILES | CCCCCCCCCCCCCCOc1ccccc1N.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C20H35NO.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-22-20-17-14-13-16-19(20)21;1-6-2-4-7(8)5-3-6/h13-14,16-17H,2-12,15,18,21H2,1H3;2-5H,8H2,1H3 |
| InChIKey | GAVAJWOWDAZTSM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylaniline;2-tetradecoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylaniline;2-tetradecoxyaniline?
The IUPAC name of 4-methylaniline;2-tetradecoxyaniline (CID 158200068) is 4-methylaniline;2-tetradecoxyaniline.
What is the SMILES notation for 4-methylaniline;2-tetradecoxyaniline?
The canonical SMILES for 4-methylaniline;2-tetradecoxyaniline is CCCCCCCCCCCCCCOc1ccccc1N.Cc1ccc(N)cc1.
What is the InChIKey of 4-methylaniline;2-tetradecoxyaniline?
The InChIKey is GAVAJWOWDAZTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-22-20-17-14-13-16-19(20)21;1-6-2-4-7(8)5-3-6/h13-14,16-17H,2-12,15,18,21H2,1H3;2-5H,8H2,1H3.
What are the key properties of 4-methylaniline;2-tetradecoxyaniline?
4-methylaniline;2-tetradecoxyaniline has a molecular weight of 412.66 g/mol, XLogP of 7.93, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylaniline;2-tetradecoxyaniline is sourced from PubChem (CID 158200068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).