C22H42Cl2N2O2 — CID 71614381
4,5-dioctoxybenzene-1,2-diamine;dihydrochloride (PubChem CID 71614381) has the molecular formula C22H42Cl2N2O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4,5-dioctoxybenzene-1,2-diamine;dihydrochloride.
| Compound Name | 4,5-dioctoxybenzene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 71614381 |
| Molecular Formula | C22H42Cl2N2O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 4,5-dioctoxybenzene-1,2-diamine;dihydrochloride |
| SMILES | CCCCCCCCOc1cc(N)c(N)cc1OCCCCCCCC.Cl.Cl |
| InChI | InChI=1S/C22H40N2O2.2ClH/c1-3-5-7-9-11-13-15-25-21-17-19(23)20(24)18-22(21)26-16-14-12-10-8-6-4-2;;/h17-18H,3-16,23-24H2,1-2H3;2*1H |
| InChIKey | FALDZSKRETTYJK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|