About 5-chloro-2-decoxyaniline
5-chloro-2-decoxyaniline (PubChem CID 55187694) has the molecular formula C16H26ClNO
and a molecular weight of 283.84 g/mol. Its IUPAC name is 5-chloro-2-decoxyaniline.
Molecular Properties
| Compound Name | 5-chloro-2-decoxyaniline |
| PubChem CID | 55187694 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-chloro-2-decoxyaniline |
| SMILES | CCCCCCCCCCOc1ccc(Cl)cc1N |
| InChI | InChI=1S/C16H26ClNO/c1-2-3-4-5-6-7-8-9-12-19-16-11-10-14(17)13-15(16)18/h10-11,13H,2-9,12,18H2,1H3 |
| InChIKey | MVPIERDAUBSNIB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-decoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-decoxyaniline?
The IUPAC name of 5-chloro-2-decoxyaniline (CID 55187694) is 5-chloro-2-decoxyaniline.
What is the SMILES notation for 5-chloro-2-decoxyaniline?
The canonical SMILES for 5-chloro-2-decoxyaniline is CCCCCCCCCCOc1ccc(Cl)cc1N.
What is the InChIKey of 5-chloro-2-decoxyaniline?
The InChIKey is MVPIERDAUBSNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClNO/c1-2-3-4-5-6-7-8-9-12-19-16-11-10-14(17)13-15(16)18/h10-11,13H,2-9,12,18H2,1H3.
What are the key properties of 5-chloro-2-decoxyaniline?
5-chloro-2-decoxyaniline has a molecular weight of 283.84 g/mol, XLogP of 5.44, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-decoxyaniline is sourced from PubChem (CID 55187694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).