About 2-methoxyaniline;4-methylaniline
2-methoxyaniline;4-methylaniline (PubChem CID 159047028) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-methoxyaniline;4-methylaniline.
Molecular Properties
| Compound Name | 2-methoxyaniline;4-methylaniline |
| PubChem CID | 159047028 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-methoxyaniline;4-methylaniline |
| SMILES | COc1ccccc1N.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9NO.C7H9N/c1-9-7-5-3-2-4-6(7)8;1-6-2-4-7(8)5-3-6/h2-5H,8H2,1H3;2-5H,8H2,1H3 |
| InChIKey | JWUBBFGSCTWMHM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyaniline;4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyaniline;4-methylaniline?
The IUPAC name of 2-methoxyaniline;4-methylaniline (CID 159047028) is 2-methoxyaniline;4-methylaniline.
What is the SMILES notation for 2-methoxyaniline;4-methylaniline?
The canonical SMILES for 2-methoxyaniline;4-methylaniline is COc1ccccc1N.Cc1ccc(N)cc1.
What is the InChIKey of 2-methoxyaniline;4-methylaniline?
The InChIKey is JWUBBFGSCTWMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C7H9N/c1-9-7-5-3-2-4-6(7)8;1-6-2-4-7(8)5-3-6/h2-5H,8H2,1H3;2-5H,8H2,1H3.
What are the key properties of 2-methoxyaniline;4-methylaniline?
2-methoxyaniline;4-methylaniline has a molecular weight of 230.31 g/mol, XLogP of 2.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyaniline;4-methylaniline is sourced from PubChem (CID 159047028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).