C7H9NO — CID 100982706
N,N-dideuterio-2-methoxyaniline (PubChem CID 100982706) has the molecular formula C7H9NO and a molecular weight of 125.17 g/mol. Its IUPAC name is N,N-dideuterio-2-methoxyaniline.
| Compound Name | N,N-dideuterio-2-methoxyaniline |
|---|---|
| PubChem CID | 100982706 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | N,N-dideuterio-2-methoxyaniline |
| SMILES | [2H]N([2H])c1ccccc1OC |
| InChI | InChI=1S/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3/i/hD2 |
| InChIKey | VMPITZXILSNTON-ZSJDYOACSA-N |
| XLogP | 1.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|