About 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride
1,2-dimethoxybenzene;molecular nitrogen;hydrochloride (PubChem CID 173306958) has the molecular formula C8H11ClN2O2
and a molecular weight of 202.64 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride.
Molecular Properties
| Compound Name | 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride |
| PubChem CID | 173306958 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride |
| SMILES | COc1ccccc1OC.Cl.N#N |
| InChI | InChI=1S/C8H10O2.ClH.N2/c1-9-7-5-3-4-6-8(7)10-2;;1-2/h3-6H,1-2H3;1H; |
| InChIKey | CGYMXQUHFFTRDJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride?
The IUPAC name of 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride (CID 173306958) is 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride.
What is the SMILES notation for 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride?
The canonical SMILES for 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride is COc1ccccc1OC.Cl.N#N.
What is the InChIKey of 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride?
The InChIKey is CGYMXQUHFFTRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.ClH.N2/c1-9-7-5-3-4-6-8(7)10-2;;1-2/h3-6H,1-2H3;1H;.
What are the key properties of 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride?
1,2-dimethoxybenzene;molecular nitrogen;hydrochloride has a molecular weight of 202.64 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxybenzene;molecular nitrogen;hydrochloride is sourced from PubChem (CID 173306958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).