About formonitrile;2-methoxyphenol
formonitrile;2-methoxyphenol (PubChem CID 161059546) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is formonitrile;2-methoxyphenol.
Molecular Properties
| Compound Name | formonitrile;2-methoxyphenol |
| PubChem CID | 161059546 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | formonitrile;2-methoxyphenol |
| SMILES | C#N.COc1ccccc1O |
| InChI | InChI=1S/C7H8O2.CHN/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3;1H |
| InChIKey | UDFHHNOSRKXEIA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formonitrile;2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;2-methoxyphenol?
The IUPAC name of formonitrile;2-methoxyphenol (CID 161059546) is formonitrile;2-methoxyphenol.
What is the SMILES notation for formonitrile;2-methoxyphenol?
The canonical SMILES for formonitrile;2-methoxyphenol is C#N.COc1ccccc1O.
What is the InChIKey of formonitrile;2-methoxyphenol?
The InChIKey is UDFHHNOSRKXEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CHN/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3;1H.
What are the key properties of formonitrile;2-methoxyphenol?
formonitrile;2-methoxyphenol has a molecular weight of 151.16 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;2-methoxyphenol is sourced from PubChem (CID 161059546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).