About methanesulfonic acid;2-methoxyphenol
methanesulfonic acid;2-methoxyphenol (PubChem CID 71332079) has the molecular formula C8H12O5S
and a molecular weight of 220.25 g/mol. Its IUPAC name is methanesulfonic acid;2-methoxyphenol.
Molecular Properties
| Compound Name | methanesulfonic acid;2-methoxyphenol |
| PubChem CID | 71332079 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | methanesulfonic acid;2-methoxyphenol |
| SMILES | COc1ccccc1O.CS(=O)(=O)O |
| InChI | InChI=1S/C7H8O2.CH4O3S/c1-9-7-5-3-2-4-6(7)8;1-5(2,3)4/h2-5,8H,1H3;1H3,(H,2,3,4) |
| InChIKey | UVPOCNWLDQDTBF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;2-methoxyphenol?
The IUPAC name of methanesulfonic acid;2-methoxyphenol (CID 71332079) is methanesulfonic acid;2-methoxyphenol.
What is the SMILES notation for methanesulfonic acid;2-methoxyphenol?
The canonical SMILES for methanesulfonic acid;2-methoxyphenol is COc1ccccc1O.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;2-methoxyphenol?
The InChIKey is UVPOCNWLDQDTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CH4O3S/c1-9-7-5-3-2-4-6(7)8;1-5(2,3)4/h2-5,8H,1H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;2-methoxyphenol?
methanesulfonic acid;2-methoxyphenol has a molecular weight of 220.25 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;2-methoxyphenol is sourced from PubChem (CID 71332079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).