About methanethiol;2-methoxyphenol
methanethiol;2-methoxyphenol (PubChem CID 141484211) has the molecular formula C8H12O2S
and a molecular weight of 172.25 g/mol. Its IUPAC name is methanethiol;2-methoxyphenol.
Molecular Properties
| Compound Name | methanethiol;2-methoxyphenol |
| PubChem CID | 141484211 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | methanethiol;2-methoxyphenol |
| SMILES | COc1ccccc1O.CS |
| InChI | InChI=1S/C7H8O2.CH4S/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3;2H,1H3 |
| InChIKey | HWWDOSJTNSRHKZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;2-methoxyphenol?
The IUPAC name of methanethiol;2-methoxyphenol (CID 141484211) is methanethiol;2-methoxyphenol.
What is the SMILES notation for methanethiol;2-methoxyphenol?
The canonical SMILES for methanethiol;2-methoxyphenol is COc1ccccc1O.CS.
What is the InChIKey of methanethiol;2-methoxyphenol?
The InChIKey is HWWDOSJTNSRHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CH4S/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3;2H,1H3.
What are the key properties of methanethiol;2-methoxyphenol?
methanethiol;2-methoxyphenol has a molecular weight of 172.25 g/mol, XLogP of 1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;2-methoxyphenol is sourced from PubChem (CID 141484211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).