About 2-methylperoxyphenol
2-methylperoxyphenol (PubChem CID 18702042) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-methylperoxyphenol.
Molecular Properties
| Compound Name | 2-methylperoxyphenol |
| PubChem CID | 18702042 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 2-methylperoxyphenol |
| SMILES | COOc1ccccc1O |
| InChI | InChI=1S/C7H8O3/c1-9-10-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| InChIKey | CWDFAWQMQXOHPJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylperoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylperoxyphenol?
The IUPAC name of 2-methylperoxyphenol (CID 18702042) is 2-methylperoxyphenol.
What is the SMILES notation for 2-methylperoxyphenol?
The canonical SMILES for 2-methylperoxyphenol is COOc1ccccc1O.
What is the InChIKey of 2-methylperoxyphenol?
The InChIKey is CWDFAWQMQXOHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-9-10-7-5-3-2-4-6(7)8/h2-5,8H,1H3.
What are the key properties of 2-methylperoxyphenol?
2-methylperoxyphenol has a molecular weight of 140.14 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylperoxyphenol is sourced from PubChem (CID 18702042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).