About ethanol;2-(trioxidanyl)phenol
ethanol;2-(trioxidanyl)phenol (PubChem CID 173403198) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is ethanol;2-(trioxidanyl)phenol.
Molecular Properties
| Compound Name | ethanol;2-(trioxidanyl)phenol |
| PubChem CID | 173403198 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | ethanol;2-(trioxidanyl)phenol |
| SMILES | CCO.OOOc1ccccc1O |
| InChI | InChI=1S/C6H6O4.C2H6O/c7-5-3-1-2-4-6(5)9-10-8;1-2-3/h1-4,7-8H;3H,2H2,1H3 |
| InChIKey | VRXVCCLCMHLETD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-(trioxidanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-(trioxidanyl)phenol?
The IUPAC name of ethanol;2-(trioxidanyl)phenol (CID 173403198) is ethanol;2-(trioxidanyl)phenol.
What is the SMILES notation for ethanol;2-(trioxidanyl)phenol?
The canonical SMILES for ethanol;2-(trioxidanyl)phenol is CCO.OOOc1ccccc1O.
What is the InChIKey of ethanol;2-(trioxidanyl)phenol?
The InChIKey is VRXVCCLCMHLETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4.C2H6O/c7-5-3-1-2-4-6(5)9-10-8;1-2-3/h1-4,7-8H;3H,2H2,1H3.
What are the key properties of ethanol;2-(trioxidanyl)phenol?
ethanol;2-(trioxidanyl)phenol has a molecular weight of 188.18 g/mol, XLogP of 1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-(trioxidanyl)phenol is sourced from PubChem (CID 173403198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).