About azane;2-methoxyphenol
azane;2-methoxyphenol (PubChem CID 172717837) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is azane;2-methoxyphenol.
Molecular Properties
| Compound Name | azane;2-methoxyphenol |
| PubChem CID | 172717837 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | azane;2-methoxyphenol |
| SMILES | COc1ccccc1O.N |
| InChI | InChI=1S/C7H8O2.H3N/c1-9-7-5-3-2-4-6(7)8;/h2-5,8H,1H3;1H3 |
| InChIKey | VGIYUPSBCCTJOX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methoxyphenol?
The IUPAC name of azane;2-methoxyphenol (CID 172717837) is azane;2-methoxyphenol.
What is the SMILES notation for azane;2-methoxyphenol?
The canonical SMILES for azane;2-methoxyphenol is COc1ccccc1O.N.
What is the InChIKey of azane;2-methoxyphenol?
The InChIKey is VGIYUPSBCCTJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.H3N/c1-9-7-5-3-2-4-6(7)8;/h2-5,8H,1H3;1H3.
What are the key properties of azane;2-methoxyphenol?
azane;2-methoxyphenol has a molecular weight of 141.17 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methoxyphenol is sourced from PubChem (CID 172717837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).