C14H16O4 — CID 161187108
2-methoxyphenol;2-methylbenzene-1,4-diol (PubChem CID 161187108) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-methoxyphenol;2-methylbenzene-1,4-diol.
| Compound Name | 2-methoxyphenol;2-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 161187108 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-methoxyphenol;2-methylbenzene-1,4-diol |
| SMILES | COc1ccccc1O.Cc1cc(O)ccc1O |
| InChI | InChI=1S/2C7H8O2/c1-5-4-6(8)2-3-7(5)9;1-9-7-5-3-2-4-6(7)8/h2-4,8-9H,1H3;2-5,8H,1H3 |
| InChIKey | UTFMTZUACXQLBA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|