About dichlorotitanium;bis(2-methoxyphenol)
dichlorotitanium;bis(2-methoxyphenol) (PubChem CID 164736686) has the molecular formula C14H16Cl2O4Ti
and a molecular weight of 367.05 g/mol. Its IUPAC name is dichlorotitanium;bis(2-methoxyphenol).
Molecular Properties
| Compound Name | dichlorotitanium;bis(2-methoxyphenol) |
| PubChem CID | 164736686 |
| Molecular Formula | C14H16Cl2O4Ti |
| Molecular Weight | 367.05 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | dichlorotitanium;bis(2-methoxyphenol) |
| SMILES | COc1ccccc1O.COc1ccccc1O.Cl[Ti]Cl |
| InChI | InChI=1S/2C7H8O2.2ClH.Ti/c2*1-9-7-5-3-2-4-6(7)8;;;/h2*2-5,8H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | HMWDBBVEHBEFIG-UHFFFAOYSA-L |
| XLogP | 4.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichlorotitanium;bis(2-methoxyphenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;bis(2-methoxyphenol)?
The IUPAC name of dichlorotitanium;bis(2-methoxyphenol) (CID 164736686) is dichlorotitanium;bis(2-methoxyphenol).
What is the SMILES notation for dichlorotitanium;bis(2-methoxyphenol)?
The canonical SMILES for dichlorotitanium;bis(2-methoxyphenol) is COc1ccccc1O.COc1ccccc1O.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;bis(2-methoxyphenol)?
The InChIKey is HMWDBBVEHBEFIG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8O2.2ClH.Ti/c2*1-9-7-5-3-2-4-6(7)8;;;/h2*2-5,8H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichlorotitanium;bis(2-methoxyphenol)?
dichlorotitanium;bis(2-methoxyphenol) has a molecular weight of 367.05 g/mol, XLogP of 4.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;bis(2-methoxyphenol) is sourced from PubChem (CID 164736686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).