C10H18N2O2 — CID 175514452
2-methoxyphenol;N'-methylethane-1,2-diamine (PubChem CID 175514452) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-methoxyphenol;N'-methylethane-1,2-diamine.
| Compound Name | 2-methoxyphenol;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 175514452 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-methoxyphenol;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.COc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C3H10N2/c1-9-7-5-3-2-4-6(7)8;1-5-3-2-4/h2-5,8H,1H3;5H,2-4H2,1H3 |
| InChIKey | PXCUHOYXENAOCK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |