About N'-ethylpropane-1,3-diamine;2-methoxyphenol
N'-ethylpropane-1,3-diamine;2-methoxyphenol (PubChem CID 175514444) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N'-ethylpropane-1,3-diamine;2-methoxyphenol.
Molecular Properties
| Compound Name | N'-ethylpropane-1,3-diamine;2-methoxyphenol |
| PubChem CID | 175514444 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N'-ethylpropane-1,3-diamine;2-methoxyphenol |
| SMILES | CCNCCCN.COc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C5H14N2/c1-9-7-5-3-2-4-6(7)8;1-2-7-5-3-4-6/h2-5,8H,1H3;7H,2-6H2,1H3 |
| InChIKey | ZDHKYXZWZXCHHX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylpropane-1,3-diamine;2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylpropane-1,3-diamine;2-methoxyphenol?
The IUPAC name of N'-ethylpropane-1,3-diamine;2-methoxyphenol (CID 175514444) is N'-ethylpropane-1,3-diamine;2-methoxyphenol.
What is the SMILES notation for N'-ethylpropane-1,3-diamine;2-methoxyphenol?
The canonical SMILES for N'-ethylpropane-1,3-diamine;2-methoxyphenol is CCNCCCN.COc1ccccc1O.
What is the InChIKey of N'-ethylpropane-1,3-diamine;2-methoxyphenol?
The InChIKey is ZDHKYXZWZXCHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C5H14N2/c1-9-7-5-3-2-4-6(7)8;1-2-7-5-3-4-6/h2-5,8H,1H3;7H,2-6H2,1H3.
What are the key properties of N'-ethylpropane-1,3-diamine;2-methoxyphenol?
N'-ethylpropane-1,3-diamine;2-methoxyphenol has a molecular weight of 226.32 g/mol, XLogP of 1.35, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylpropane-1,3-diamine;2-methoxyphenol is sourced from PubChem (CID 175514444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).