C12H22N2O2 — CID 175514444
N'-ethylpropane-1,3-diamine;2-methoxyphenol (PubChem CID 175514444) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N'-ethylpropane-1,3-diamine;2-methoxyphenol.
| Compound Name | N'-ethylpropane-1,3-diamine;2-methoxyphenol |
|---|---|
| PubChem CID | 175514444 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N'-ethylpropane-1,3-diamine;2-methoxyphenol |
| SMILES | CCNCCCN.COc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C5H14N2/c1-9-7-5-3-2-4-6(7)8;1-2-7-5-3-4-6/h2-5,8H,1H3;7H,2-6H2,1H3 |
| InChIKey | ZDHKYXZWZXCHHX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|