About 2-methoxyphenol;molecular bromine
2-methoxyphenol;molecular bromine (PubChem CID 141484212) has the molecular formula C7H8Br2O2
and a molecular weight of 283.95 g/mol. Its IUPAC name is 2-methoxyphenol;molecular bromine.
Molecular Properties
| Compound Name | 2-methoxyphenol;molecular bromine |
| PubChem CID | 141484212 |
| Molecular Formula | C7H8Br2O2 |
| Molecular Weight | 283.95 g/mol |
| Exact Mass | 281.89 |
| IUPAC Name | 2-methoxyphenol;molecular bromine |
| SMILES | BrBr.COc1ccccc1O |
| InChI | InChI=1S/C7H8O2.Br2/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3; |
| InChIKey | DRCPEIWMWMKLAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxyphenol;molecular bromine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyphenol;molecular bromine?
The IUPAC name of 2-methoxyphenol;molecular bromine (CID 141484212) is 2-methoxyphenol;molecular bromine.
What is the SMILES notation for 2-methoxyphenol;molecular bromine?
The canonical SMILES for 2-methoxyphenol;molecular bromine is BrBr.COc1ccccc1O.
What is the InChIKey of 2-methoxyphenol;molecular bromine?
The InChIKey is DRCPEIWMWMKLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.Br2/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,8H,1H3;.
What are the key properties of 2-methoxyphenol;molecular bromine?
2-methoxyphenol;molecular bromine has a molecular weight of 283.95 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyphenol;molecular bromine is sourced from PubChem (CID 141484212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).