C8H13NO2 — CID 174437926
azane;1,2-dimethoxybenzene (PubChem CID 174437926) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is azane;1,2-dimethoxybenzene.
| Compound Name | azane;1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 174437926 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | azane;1,2-dimethoxybenzene |
| SMILES | COc1ccccc1OC.N |
| InChI | InChI=1S/C8H10O2.H3N/c1-9-7-5-3-4-6-8(7)10-2;/h3-6H,1-2H3;1H3 |
| InChIKey | GTLACISEWBSQBV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |