C18H22O2 — CID 170157168
bis(cyclopenta-1,3-diene);1,2-dimethoxybenzene (PubChem CID 170157168) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);1,2-dimethoxybenzene.
| Compound Name | bis(cyclopenta-1,3-diene);1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 170157168 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | bis(cyclopenta-1,3-diene);1,2-dimethoxybenzene |
| SMILES | C1=CCC=C1.C1=CCC=C1.COc1ccccc1OC |
| InChI | InChI=1S/C8H10O2.2C5H6/c1-9-7-5-3-4-6-8(7)10-2;2*1-2-4-5-3-1/h3-6H,1-2H3;2*1-4H,5H2 |
| InChIKey | YCRMGSULYWBIJI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |