C10H13NRu — CID 174581939
cyclopenta-1,3-diene;2-methyl-1H-pyrrole;ruthenium (PubChem CID 174581939) has the molecular formula C10H13NRu and a molecular weight of 248.29 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-methyl-1H-pyrrole;ruthenium.
| Compound Name | cyclopenta-1,3-diene;2-methyl-1H-pyrrole;ruthenium |
|---|---|
| PubChem CID | 174581939 |
| Molecular Formula | C10H13NRu |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | cyclopenta-1,3-diene;2-methyl-1H-pyrrole;ruthenium |
| SMILES | C1=CCC=C1.Cc1ccc[nH]1.[Ru] |
| InChI | InChI=1S/C5H7N.C5H6.Ru/c1-5-3-2-4-6-5;1-2-4-5-3-1;/h2-4,6H,1H3;1-4H,5H2; |
| InChIKey | NZYPSYHRJSXBDP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |