C15H23NRu — CID 174567261
cyclopenta-1,3-diene;2,3-dipropyl-1H-pyrrole;ruthenium (PubChem CID 174567261) has the molecular formula C15H23NRu and a molecular weight of 318.43 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2,3-dipropyl-1H-pyrrole;ruthenium.
| Compound Name | cyclopenta-1,3-diene;2,3-dipropyl-1H-pyrrole;ruthenium |
|---|---|
| PubChem CID | 174567261 |
| Molecular Formula | C15H23NRu |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | cyclopenta-1,3-diene;2,3-dipropyl-1H-pyrrole;ruthenium |
| SMILES | C1=CCC=C1.CCCc1cc[nH]c1CCC.[Ru] |
| InChI | InChI=1S/C10H17N.C5H6.Ru/c1-3-5-9-7-8-11-10(9)6-4-2;1-2-4-5-3-1;/h7-8,11H,3-6H2,1-2H3;1-4H,5H2; |
| InChIKey | SMBQZTCDAYRHFF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |