About 2-methyl-1H-pyrrole;quinoline
2-methyl-1H-pyrrole;quinoline (PubChem CID 158830391) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-methyl-1H-pyrrole;quinoline.
Molecular Properties
| Compound Name | 2-methyl-1H-pyrrole;quinoline |
| PubChem CID | 158830391 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-methyl-1H-pyrrole;quinoline |
| SMILES | Cc1ccc[nH]1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C5H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-5-3-2-4-6-5/h1-7H;2-4,6H,1H3 |
| InChIKey | IWYVHNFFMFTARZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1H-pyrrole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-pyrrole;quinoline?
The IUPAC name of 2-methyl-1H-pyrrole;quinoline (CID 158830391) is 2-methyl-1H-pyrrole;quinoline.
What is the SMILES notation for 2-methyl-1H-pyrrole;quinoline?
The canonical SMILES for 2-methyl-1H-pyrrole;quinoline is Cc1ccc[nH]1.c1ccc2ncccc2c1.
What is the InChIKey of 2-methyl-1H-pyrrole;quinoline?
The InChIKey is IWYVHNFFMFTARZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-5-3-2-4-6-5/h1-7H;2-4,6H,1H3.
What are the key properties of 2-methyl-1H-pyrrole;quinoline?
2-methyl-1H-pyrrole;quinoline has a molecular weight of 210.28 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-pyrrole;quinoline is sourced from PubChem (CID 158830391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).