About 1-methyl-2H-isoindole;quinoline
1-methyl-2H-isoindole;quinoline (PubChem CID 158130411) has the molecular formula C18H16N2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-methyl-2H-isoindole;quinoline.
Molecular Properties
| Compound Name | 1-methyl-2H-isoindole;quinoline |
| PubChem CID | 158130411 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-methyl-2H-isoindole;quinoline |
| SMILES | Cc1[nH]cc2ccccc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H9N.C9H7N/c1-7-9-5-3-2-4-8(9)6-10-7;1-2-6-9-8(4-1)5-3-7-10-9/h2-6,10H,1H3;1-7H |
| InChIKey | FSRYTXADSOGMDA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2H-isoindole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-isoindole;quinoline?
The IUPAC name of 1-methyl-2H-isoindole;quinoline (CID 158130411) is 1-methyl-2H-isoindole;quinoline.
What is the SMILES notation for 1-methyl-2H-isoindole;quinoline?
The canonical SMILES for 1-methyl-2H-isoindole;quinoline is Cc1[nH]cc2ccccc12.c1ccc2ncccc2c1.
What is the InChIKey of 1-methyl-2H-isoindole;quinoline?
The InChIKey is FSRYTXADSOGMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C9H7N/c1-7-9-5-3-2-4-8(9)6-10-7;1-2-6-9-8(4-1)5-3-7-10-9/h2-6,10H,1H3;1-7H.
What are the key properties of 1-methyl-2H-isoindole;quinoline?
1-methyl-2H-isoindole;quinoline has a molecular weight of 260.34 g/mol, XLogP of 4.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-isoindole;quinoline is sourced from PubChem (CID 158130411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).