About 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine
2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine (PubChem CID 174934700) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine.
Molecular Properties
| Compound Name | 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine |
| PubChem CID | 174934700 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine |
| SMILES | C=CCc1ncccn1.Cc1ccc[nH]1 |
| InChI | InChI=1S/C7H8N2.C5H7N/c1-2-4-7-8-5-3-6-9-7;1-5-3-2-4-6-5/h2-3,5-6H,1,4H2;2-4,6H,1H3 |
| InChIKey | NBGRTDPJLWMORS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine?
The IUPAC name of 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine (CID 174934700) is 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine.
What is the SMILES notation for 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine?
The canonical SMILES for 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine is C=CCc1ncccn1.Cc1ccc[nH]1.
What is the InChIKey of 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine?
The InChIKey is NBGRTDPJLWMORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.C5H7N/c1-2-4-7-8-5-3-6-9-7;1-5-3-2-4-6-5/h2-3,5-6H,1,4H2;2-4,6H,1H3.
What are the key properties of 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine?
2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine has a molecular weight of 201.27 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-pyrrole;2-prop-2-enylpyrimidine is sourced from PubChem (CID 174934700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).