C8H12Cl2O2 — CID 19834650
1,2-dimethoxybenzene;dihydrochloride (PubChem CID 19834650) has the molecular formula C8H12Cl2O2 and a molecular weight of 211.09 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;dihydrochloride.
| Compound Name | 1,2-dimethoxybenzene;dihydrochloride |
|---|---|
| PubChem CID | 19834650 |
| Molecular Formula | C8H12Cl2O2 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1,2-dimethoxybenzene;dihydrochloride |
| SMILES | COc1ccccc1OC.Cl.Cl |
| InChI | InChI=1S/C8H10O2.2ClH/c1-9-7-5-3-4-6-8(7)10-2;;/h3-6H,1-2H3;2*1H |
| InChIKey | HUCCBABZAHAOFU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |