About 2-methoxyaniline;titanium;trihydrochloride
2-methoxyaniline;titanium;trihydrochloride (PubChem CID 174872226) has the molecular formula C7H12Cl3NOTi
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-methoxyaniline;titanium;trihydrochloride.
Molecular Properties
| Compound Name | 2-methoxyaniline;titanium;trihydrochloride |
| PubChem CID | 174872226 |
| Molecular Formula | C7H12Cl3NOTi |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 2-methoxyaniline;titanium;trihydrochloride |
| SMILES | COc1ccccc1N.Cl.Cl.Cl.[Ti] |
| InChI | InChI=1S/C7H9NO.3ClH.Ti/c1-9-7-5-3-2-4-6(7)8;;;;/h2-5H,8H2,1H3;3*1H; |
| InChIKey | MRAWGSMHXQGBPS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyaniline;titanium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyaniline;titanium;trihydrochloride?
The IUPAC name of 2-methoxyaniline;titanium;trihydrochloride (CID 174872226) is 2-methoxyaniline;titanium;trihydrochloride.
What is the SMILES notation for 2-methoxyaniline;titanium;trihydrochloride?
The canonical SMILES for 2-methoxyaniline;titanium;trihydrochloride is COc1ccccc1N.Cl.Cl.Cl.[Ti].
What is the InChIKey of 2-methoxyaniline;titanium;trihydrochloride?
The InChIKey is MRAWGSMHXQGBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.3ClH.Ti/c1-9-7-5-3-2-4-6(7)8;;;;/h2-5H,8H2,1H3;3*1H;.
What are the key properties of 2-methoxyaniline;titanium;trihydrochloride?
2-methoxyaniline;titanium;trihydrochloride has a molecular weight of 280.41 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyaniline;titanium;trihydrochloride is sourced from PubChem (CID 174872226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).