About ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline
ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline (PubChem CID 144760759) has the molecular formula C19H30FNO
and a molecular weight of 307.45 g/mol. Its IUPAC name is ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline.
Molecular Properties
| Compound Name | ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline |
| PubChem CID | 144760759 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline |
| SMILES | CC.CC.CCc1ccccc1F.COc1ccccc1N |
| InChI | InChI=1S/C8H9F.C7H9NO.2C2H6/c1-2-7-5-3-4-6-8(7)9;1-9-7-5-3-2-4-6(7)8;2*1-2/h3-6H,2H2,1H3;2-5H,8H2,1H3;2*1-2H3 |
| InChIKey | IMTFKIOKOWLDEB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline?
The IUPAC name of ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline (CID 144760759) is ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline.
What is the SMILES notation for ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline?
The canonical SMILES for ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline is CC.CC.CCc1ccccc1F.COc1ccccc1N.
What is the InChIKey of ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline?
The InChIKey is IMTFKIOKOWLDEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F.C7H9NO.2C2H6/c1-2-7-5-3-4-6-8(7)9;1-9-7-5-3-2-4-6(7)8;2*1-2/h3-6H,2H2,1H3;2-5H,8H2,1H3;2*1-2H3.
What are the key properties of ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline?
ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline has a molecular weight of 307.45 g/mol, XLogP of 5.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2-fluorobenzene;2-methoxyaniline is sourced from PubChem (CID 144760759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).