About azane;1-ethyl-2-fluorobenzene
azane;1-ethyl-2-fluorobenzene (PubChem CID 66657049) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is azane;1-ethyl-2-fluorobenzene.
Molecular Properties
| Compound Name | azane;1-ethyl-2-fluorobenzene |
| PubChem CID | 66657049 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | azane;1-ethyl-2-fluorobenzene |
| SMILES | CCc1ccccc1F.N |
| InChI | InChI=1S/C8H9F.H3N/c1-2-7-5-3-4-6-8(7)9;/h3-6H,2H2,1H3;1H3 |
| InChIKey | KTPGSARFPYFSDE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-ethyl-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethyl-2-fluorobenzene?
The IUPAC name of azane;1-ethyl-2-fluorobenzene (CID 66657049) is azane;1-ethyl-2-fluorobenzene.
What is the SMILES notation for azane;1-ethyl-2-fluorobenzene?
The canonical SMILES for azane;1-ethyl-2-fluorobenzene is CCc1ccccc1F.N.
What is the InChIKey of azane;1-ethyl-2-fluorobenzene?
The InChIKey is KTPGSARFPYFSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F.H3N/c1-2-7-5-3-4-6-8(7)9;/h3-6H,2H2,1H3;1H3.
What are the key properties of azane;1-ethyl-2-fluorobenzene?
azane;1-ethyl-2-fluorobenzene has a molecular weight of 141.19 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethyl-2-fluorobenzene is sourced from PubChem (CID 66657049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).