About carbonic acid;1-ethyl-2-fluorobenzene
carbonic acid;1-ethyl-2-fluorobenzene (PubChem CID 174964119) has the molecular formula C9H11FO3
and a molecular weight of 186.18 g/mol. Its IUPAC name is carbonic acid;1-ethyl-2-fluorobenzene.
Molecular Properties
| Compound Name | carbonic acid;1-ethyl-2-fluorobenzene |
| PubChem CID | 174964119 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | carbonic acid;1-ethyl-2-fluorobenzene |
| SMILES | CCc1ccccc1F.O=C(O)O |
| InChI | InChI=1S/C8H9F.CH2O3/c1-2-7-5-3-4-6-8(7)9;2-1(3)4/h3-6H,2H2,1H3;(H2,2,3,4) |
| InChIKey | HEDFSYZSDBPKDG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbonic acid;1-ethyl-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-ethyl-2-fluorobenzene?
The IUPAC name of carbonic acid;1-ethyl-2-fluorobenzene (CID 174964119) is carbonic acid;1-ethyl-2-fluorobenzene.
What is the SMILES notation for carbonic acid;1-ethyl-2-fluorobenzene?
The canonical SMILES for carbonic acid;1-ethyl-2-fluorobenzene is CCc1ccccc1F.O=C(O)O.
What is the InChIKey of carbonic acid;1-ethyl-2-fluorobenzene?
The InChIKey is HEDFSYZSDBPKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F.CH2O3/c1-2-7-5-3-4-6-8(7)9;2-1(3)4/h3-6H,2H2,1H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-ethyl-2-fluorobenzene?
carbonic acid;1-ethyl-2-fluorobenzene has a molecular weight of 186.18 g/mol, XLogP of 2.61, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-ethyl-2-fluorobenzene is sourced from PubChem (CID 174964119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).