C10H17NO2 — CID 145233133
2,6-dimethoxyaniline;ethane (PubChem CID 145233133) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,6-dimethoxyaniline;ethane.
| Compound Name | 2,6-dimethoxyaniline;ethane |
|---|---|
| PubChem CID | 145233133 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2,6-dimethoxyaniline;ethane |
| SMILES | CC.COc1cccc(OC)c1N |
| InChI | InChI=1S/C8H11NO2.C2H6/c1-10-6-4-3-5-7(11-2)8(6)9;1-2/h3-5H,9H2,1-2H3;1-2H3 |
| InChIKey | WDYAQMRJBIJTIV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|