C17H20N2O4S — CID 159333940
2,6-dimethoxyaniline;2-isothiocyanato-1,3-dimethoxybenzene (PubChem CID 159333940) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2,6-dimethoxyaniline;2-isothiocyanato-1,3-dimethoxybenzene.
| Compound Name | 2,6-dimethoxyaniline;2-isothiocyanato-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 159333940 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2,6-dimethoxyaniline;2-isothiocyanato-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1N.COc1cccc(OC)c1N=C=S |
| InChI | InChI=1S/C9H9NO2S.C8H11NO2/c1-11-7-4-3-5-8(12-2)9(7)10-6-13;1-10-6-4-3-5-7(11-2)8(6)9/h3-5H,1-2H3;3-5H,9H2,1-2H3 |
| InChIKey | LFHDEUFJGYZWED-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|