C8H14N2O2 — CID 174908169
methanol;3-methoxybenzene-1,2-diamine (PubChem CID 174908169) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is methanol;3-methoxybenzene-1,2-diamine.
| Compound Name | methanol;3-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 174908169 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | methanol;3-methoxybenzene-1,2-diamine |
| SMILES | CO.COc1cccc(N)c1N |
| InChI | InChI=1S/C7H10N2O.CH4O/c1-10-6-4-2-3-5(8)7(6)9;1-2/h2-4H,8-9H2,1H3;2H,1H3 |
| InChIKey | LOQNOHSLGNNEMJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|