C15H14N2O — CID 102223785
2-[2-(2-methoxyphenyl)ethynyl]benzene-1,3-diamine (PubChem CID 102223785) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)ethynyl]benzene-1,3-diamine.
| Compound Name | 2-[2-(2-methoxyphenyl)ethynyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 102223785 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)ethynyl]benzene-1,3-diamine |
| SMILES | COc1ccccc1C#Cc1c(N)cccc1N |
| InChI | InChI=1S/C15H14N2O/c1-18-15-8-3-2-5-11(15)9-10-12-13(16)6-4-7-14(12)17/h2-8H,16-17H2,1H3 |
| InChIKey | MDOSLYQNBQHTFU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|