C13H13ClO4 — CID 157388501
2-chlorobenzene-1,4-diol;2-methylbenzene-1,4-diol (PubChem CID 157388501) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-chlorobenzene-1,4-diol;2-methylbenzene-1,4-diol.
| Compound Name | 2-chlorobenzene-1,4-diol;2-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 157388501 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-chlorobenzene-1,4-diol;2-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)ccc1O.Oc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C7H8O2.C6H5ClO2/c1-5-4-6(8)2-3-7(5)9;7-5-3-4(8)1-2-6(5)9/h2-4,8-9H,1H3;1-3,8-9H |
| InChIKey | BLSIPZCJVXHKOM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|