C18H12Cl6O3 — CID 160811430
2,4-dichlorophenol;2,5-dichlorophenol;3,4-dichlorophenol (PubChem CID 160811430) has the molecular formula C18H12Cl6O3 and a molecular weight of 489.01 g/mol. Its IUPAC name is 2,4-dichlorophenol;2,5-dichlorophenol;3,4-dichlorophenol.
| Compound Name | 2,4-dichlorophenol;2,5-dichlorophenol;3,4-dichlorophenol |
|---|---|
| PubChem CID | 160811430 |
| Molecular Formula | C18H12Cl6O3 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 485.89 |
| IUPAC Name | 2,4-dichlorophenol;2,5-dichlorophenol;3,4-dichlorophenol |
| SMILES | Oc1cc(Cl)ccc1Cl.Oc1ccc(Cl)c(Cl)c1.Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/3C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4;7-5-2-1-4(9)3-6(5)8;7-4-1-2-5(8)6(9)3-4/h3*1-3,9H |
| InChIKey | SEIQLMSRGNZNRM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |