About CID 131883434
CID 131883434 (PubChem CID 131883434) has the molecular formula C6H4Cl2KO
and a molecular weight of 202.10 g/mol.
Molecular Properties
| Compound Name | CID 131883434 |
| PubChem CID | 131883434 |
| Molecular Formula | C6H4Cl2KO |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 200.93 |
| IUPAC Name | — |
| SMILES | Oc1cc(Cl)ccc1Cl.[K] |
| InChI | InChI=1S/C6H4Cl2O.K/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H; |
| InChIKey | QQDAXBKAPINROG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 131883434 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131883434?
The IUPAC name of CID 131883434 (CID 131883434) is not available.
What is the SMILES notation for CID 131883434?
The canonical SMILES for CID 131883434 is Oc1cc(Cl)ccc1Cl.[K].
What is the InChIKey of CID 131883434?
The InChIKey is QQDAXBKAPINROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2O.K/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H;.
What are the key properties of CID 131883434?
CID 131883434 has a molecular weight of 202.10 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131883434 is sourced from PubChem (CID 131883434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).