C6H5ClO2 — CID 171689350
4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol (PubChem CID 171689350) has the molecular formula C6H5ClO2 and a molecular weight of 150.51 g/mol. Its IUPAC name is 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol.
| Compound Name | 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol |
|---|---|
| PubChem CID | 171689350 |
| Molecular Formula | C6H5ClO2 |
| Molecular Weight | 150.51 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol |
| SMILES | O[13c]1[13cH][13cH][13c](Cl)[13cH][13c]1O |
| InChI | InChI=1S/C6H5ClO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | WWOBYPKUYODHDG-IDEBNGHGSA-N |
| XLogP | 1.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|