About sodium;2-bromo-4-chlorophenol;hydride
sodium;2-bromo-4-chlorophenol;hydride (PubChem CID 175199466) has the molecular formula C6H5BrClNaO
and a molecular weight of 231.45 g/mol. Its IUPAC name is sodium;2-bromo-4-chlorophenol;hydride.
Molecular Properties
| Compound Name | sodium;2-bromo-4-chlorophenol;hydride |
| PubChem CID | 175199466 |
| Molecular Formula | C6H5BrClNaO |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | sodium;2-bromo-4-chlorophenol;hydride |
| SMILES | Oc1ccc(Cl)cc1Br.[H-].[Na+] |
| InChI | InChI=1S/C6H4BrClO.Na.H/c7-5-3-4(8)1-2-6(5)9;;/h1-3,9H;;/q;+1;-1 |
| InChIKey | UBKPWXZSEDBEPK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;2-bromo-4-chlorophenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-bromo-4-chlorophenol;hydride?
The IUPAC name of sodium;2-bromo-4-chlorophenol;hydride (CID 175199466) is sodium;2-bromo-4-chlorophenol;hydride.
What is the SMILES notation for sodium;2-bromo-4-chlorophenol;hydride?
The canonical SMILES for sodium;2-bromo-4-chlorophenol;hydride is Oc1ccc(Cl)cc1Br.[H-].[Na+].
What is the InChIKey of sodium;2-bromo-4-chlorophenol;hydride?
The InChIKey is UBKPWXZSEDBEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrClO.Na.H/c7-5-3-4(8)1-2-6(5)9;;/h1-3,9H;;/q;+1;-1.
What are the key properties of sodium;2-bromo-4-chlorophenol;hydride?
sodium;2-bromo-4-chlorophenol;hydride has a molecular weight of 231.45 g/mol, XLogP of -0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-bromo-4-chlorophenol;hydride is sourced from PubChem (CID 175199466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).