C7H8Br2O2 — CID 174690931
2,4-dibromophenol;methanol (PubChem CID 174690931) has the molecular formula C7H8Br2O2 and a molecular weight of 283.95 g/mol. Its IUPAC name is 2,4-dibromophenol;methanol.
| Compound Name | 2,4-dibromophenol;methanol |
|---|---|
| PubChem CID | 174690931 |
| Molecular Formula | C7H8Br2O2 |
| Molecular Weight | 283.95 g/mol |
| Exact Mass | 281.89 |
| IUPAC Name | 2,4-dibromophenol;methanol |
| SMILES | CO.Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H4Br2O.CH4O/c7-4-1-2-6(9)5(8)3-4;1-2/h1-3,9H;2H,1H3 |
| InChIKey | WHBWPLVDNAHCDS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.95 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |