About 2-amino-4-bromophenol;hydrochloride
2-amino-4-bromophenol;hydrochloride (PubChem CID 46738123) has the molecular formula C6H7BrClNO
and a molecular weight of 224.49 g/mol. Its IUPAC name is 2-amino-4-bromophenol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4-bromophenol;hydrochloride |
| PubChem CID | 46738123 |
| Molecular Formula | C6H7BrClNO |
| Molecular Weight | 224.49 g/mol |
| Exact Mass | 222.94 |
| IUPAC Name | 2-amino-4-bromophenol;hydrochloride |
| SMILES | Cl.Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C6H6BrNO.ClH/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H,8H2;1H |
| InChIKey | QPIYEAMFMMNUEX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-bromophenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromophenol;hydrochloride?
The IUPAC name of 2-amino-4-bromophenol;hydrochloride (CID 46738123) is 2-amino-4-bromophenol;hydrochloride.
What is the SMILES notation for 2-amino-4-bromophenol;hydrochloride?
The canonical SMILES for 2-amino-4-bromophenol;hydrochloride is Cl.Nc1cc(Br)ccc1O.
What is the InChIKey of 2-amino-4-bromophenol;hydrochloride?
The InChIKey is QPIYEAMFMMNUEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO.ClH/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H,8H2;1H.
What are the key properties of 2-amino-4-bromophenol;hydrochloride?
2-amino-4-bromophenol;hydrochloride has a molecular weight of 224.49 g/mol, XLogP of 2.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromophenol;hydrochloride is sourced from PubChem (CID 46738123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).