About 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide
2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide (PubChem CID 121267638) has the molecular formula C14H14Br2N2O3
and a molecular weight of 418.09 g/mol. Its IUPAC name is 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide |
| PubChem CID | 121267638 |
| Molecular Formula | C14H14Br2N2O3 |
| Molecular Weight | 418.09 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Br)ccc1O.Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C8H8BrNO2.C6H6BrNO/c1-5(11)10-7-4-6(9)2-3-8(7)12;7-4-1-2-6(9)5(8)3-4/h2-4,12H,1H3,(H,10,11);1-3,9H,8H2 |
| InChIKey | CPPVDBUUDMUWNN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.09 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide?
The IUPAC name of 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide (CID 121267638) is 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide.
What is the SMILES notation for 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide?
The canonical SMILES for 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide is CC(=O)Nc1cc(Br)ccc1O.Nc1cc(Br)ccc1O.
What is the InChIKey of 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide?
The InChIKey is CPPVDBUUDMUWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2.C6H6BrNO/c1-5(11)10-7-4-6(9)2-3-8(7)12;7-4-1-2-6(9)5(8)3-4/h2-4,12H,1H3,(H,10,11);1-3,9H,8H2.
What are the key properties of 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide?
2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide has a molecular weight of 418.09 g/mol, XLogP of 3.85, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromophenol;N-(5-bromo-2-hydroxyphenyl)acetamide is sourced from PubChem (CID 121267638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).