C17H18Br2N2O4 — CID 121410401
N-(5-bromo-2-hydroxyphenyl)acetamide;N-(5-bromo-2-methoxyphenyl)acetamide (PubChem CID 121410401) has the molecular formula C17H18Br2N2O4 and a molecular weight of 474.15 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxyphenyl)acetamide;N-(5-bromo-2-methoxyphenyl)acetamide.
| Compound Name | N-(5-bromo-2-hydroxyphenyl)acetamide;N-(5-bromo-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 121410401 |
| Molecular Formula | C17H18Br2N2O4 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | N-(5-bromo-2-hydroxyphenyl)acetamide;N-(5-bromo-2-methoxyphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Br)ccc1O.COc1ccc(Br)cc1NC(C)=O |
| InChI | InChI=1S/C9H10BrNO2.C8H8BrNO2/c1-6(12)11-8-5-7(10)3-4-9(8)13-2;1-5(11)10-7-4-6(9)2-3-8(7)12/h3-5H,1-2H3,(H,11,12);2-4,12H,1H3,(H,10,11) |
| InChIKey | QOMRFKRLSQCCBX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|