C11H5BrN4O — CID 168606210
2-(5-bromo-2-hydroxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168606210) has the molecular formula C11H5BrN4O and a molecular weight of 289.09 g/mol. Its IUPAC name is 2-(5-bromo-2-hydroxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(5-bromo-2-hydroxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606210 |
| Molecular Formula | C11H5BrN4O |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 2-(5-bromo-2-hydroxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C11H5BrN4O/c12-8-1-2-11(17)9(3-8)16-10(6-15)7(4-13)5-14/h1-3,16-17H |
| InChIKey | KDKLTLFINNRAAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|