C14H9BrN4O3 — CID 168608780
methyl 5-bromo-2-methoxy-3-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168608780) has the molecular formula C14H9BrN4O3 and a molecular weight of 361.16 g/mol. Its IUPAC name is methyl 5-bromo-2-methoxy-3-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | methyl 5-bromo-2-methoxy-3-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168608780 |
| Molecular Formula | C14H9BrN4O3 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | methyl 5-bromo-2-methoxy-3-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | COC(=O)c1cc(Br)cc(NC(C#N)=C(C#N)C#N)c1OC |
| InChI | InChI=1S/C14H9BrN4O3/c1-21-13-10(14(20)22-2)3-9(15)4-11(13)19-12(7-18)8(5-16)6-17/h3-4,19H,1-2H3 |
| InChIKey | RRJBPYBYRKIYOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|