C14H10N4O4S — CID 168609751
methyl 5-methylsulfonyl-2-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168609751) has the molecular formula C14H10N4O4S and a molecular weight of 330.33 g/mol. Its IUPAC name is methyl 5-methylsulfonyl-2-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | methyl 5-methylsulfonyl-2-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168609751 |
| Molecular Formula | C14H10N4O4S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | methyl 5-methylsulfonyl-2-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | COC(=O)c1cc(S(C)(=O)=O)ccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C14H10N4O4S/c1-22-14(19)11-5-10(23(2,20)21)3-4-12(11)18-13(8-17)9(6-15)7-16/h3-5,18H,1-2H3 |
| InChIKey | SCPSMHDQCHNVDN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|